Atomic Mass of Ethyl 3-Bromopropionate: A Comprehensive Overview
Understanding the atomic mass of ethyl 3-bromopropionate is crucial for various scientific and industrial applications. This compound, also known as 3-bromo-1-propanol, plays a significant role in organic synthesis and pharmaceuticals. In this article, we delve into the details of its atomic mass, molecular structure, and properties.
What is Ethyl 3-Bromopropionate?
Ethyl 3-bromopropionate is an organic compound with the chemical formula C4H7BrO. It is a colorless liquid with a pungent odor. This compound is commonly used as a solvent in the synthesis of various organic compounds and as a reagent in chemical reactions.
Atomic Mass of Ethyl 3-Bromopropionate
The atomic mass of ethyl 3-bromopropionate can be calculated by summing the atomic masses of its constituent atoms. The atomic mass of carbon (C) is 12.011, hydrogen (H) is 1.008, bromine (Br) is 79.904, and oxygen (O) is 15.999. The molecular formula of ethyl 3-bromopropionate is C4H7BrO, so its atomic mass is as follows:
| Element | Atomic Mass | Number of Atoms | Total Atomic Mass |
|---|---|---|---|
| Carbon (C) | 12.011 | 4 | 48.044 |
| Hydrogen (H) | 1.008 | 7 | 7.056 |
| Bromine (Br) | 79.904 | 1 | 79.904 |
| Oxygen (O) | 15.999 | 1 | 15.999 |
| Total | 140.003 |
Therefore, the atomic mass of ethyl 3-bromopropionate is approximately 140.003 atomic mass units (amu).
Molecular Structure of Ethyl 3-Bromopropionate
The molecular structure of ethyl 3-bromopropionate consists of a 3-bromopropyl group attached to an ethyl group. The 3-bromopropyl group has a bromine atom attached to the third carbon atom of a propyl chain, while the ethyl group consists of two carbon atoms and five hydrogen atoms. The structure can be represented as follows:
CH3-CH2-CH(Br)-CH2-O-CH2-CH3
Properties of Ethyl 3-Bromopropionate
Ethyl 3-bromopropionate has several properties that make it useful in various applications:
- Boiling Point: The boiling point of ethyl 3-bromopropionate is approximately 102.5掳C.
- Melting Point: The melting point of ethyl 3-bromopropionate is around -42掳C.
- Solubility: Ethyl 3-bromopropionate is soluble in water, alcohol, and ether.
- Odor: It has a pungent odor, which can be irritating to the respiratory system.
Applications of Ethyl 3-Bromopropionate
Ethyl 3-bromopropionate finds applications in various fields, including:
- Organic Synthesis: It is used as a building block in the synthesis of various organic compounds, such as esters, ethers, and alcohols.
